Boronic acid derivatives
Sigma Aldrich 4-Pyridinylboronic Acid
MilliporeSigma Sigma Organics products encompass a wide range of quality reagents, solvents, catalysts, and building blocks for organic synthesis. From benchtop discovery to process development and scale-up, Sigma Organics solutions are built to meet the needs of synthetic chemists.
Sigma Aldrich 4-Amino-pyridine-2-carboxylic acid methyl ester
MilliporeSigma Sigma Organics products encompass a wide range of quality reagents, solvents, catalysts, and building blocks for organic synthesis. From benchtop discovery to process development and scale-up, Sigma Organics solutions are built to meet the needs of synthetic chemists.
Aobchem 2-Bromo-6-fluorophenylboronic acid pinacol ester | ≥95% | CAS 1595078-06-0 | C12H15BBrFO2 | 5g
2-Bromo-6-fluorophenylboronic acid pinacol ester | ≥95% | CAS 1595078-06-0 | C12H15BBrFO2 | 5g
Aobchem 2 4 6-Trimethylphenylboronic acid pinacol ester | ≥97% | CAS 171364-84-4 | C15H23BO2 | 10g
2 4 6-Trimethylphenylboronic acid pinacol ester | ≥97% | CAS 171364-84-4 | C15H23BO2 | 10g
Aobchem 3-Ethoxy-2-fluorophenylboronic acid | ≥97% | CAS 855230-61-4 | C8H10BFO3 | 10g
3-Ethoxy-2-fluorophenylboronic acid | ≥97% | CAS 855230-61-4 | C8H10BFO3 | 10g
eMolecules 6336-34-1 | Medchem Express | OUL35 | 5mg | 599150558 | HY-123512 | MFCD00437390 | 256.261 | C14H12N2O3
Medchem Express | OUL35 | 5mg | 599150558 | HY-123512 | 6336-34-1 | MFCD00437390 | 256.261 | C14H12N2O3
Aobchem 2-Isopropylboronic acid pinacol ester | 95% | CAS 76347-13-2 | C9H19BO2 | 100g
2-Isopropylboronic acid pinacol ester | 95% | CAS 76347-13-2 | C9H19BO2 | 100g
Aobchem Quinoline-4-boronic acid pinacolate | 95% | CAS 1035458-54-8 | C15H18BNO2 | 500mg
Quinoline-4-boronic acid pinacolate | 95% | CAS 1035458-54-8 | C15H18BNO2 | 500mg
eMolecules 126689-01-8 | Cyclopropylboronic acid pinacol ester | Synthonix - Stock | MFCD05663847 | 168.040 | C9H17BO2 | 97.000 | CC1(C)OB(OC1(C)C)C1CC1 | 5g | 525912951
Cyclopropylboronic acid pinacol ester | Synthonix - Stock | 126689-01-8 | MFCD05663847 | 168.040 | C9H17BO2 | 97.000 | CC1(C)OB(OC1(C)C)C1CC1 | 5g | 525912951
eMolecules 72824-04-5 | Allylboronic acid pinacol ester | Ambeed | MFCD00013347 | 168.040 | C9H17BO2 | 97.000 | CC1(C)OB(CC=C)OC1(C)C | 25g | 552538920
Allylboronic acid pinacol ester | Ambeed | 72824-04-5 | MFCD00013347 | 168.040 | C9H17BO2 | 97.000 | CC1(C)OB(CC=C)OC1(C)C | 25g | 552538920
eMolecules 411235-57-9 | Cyclopropylboronic acid | Combi-Blocks | MFCD04038750 | 85.900 | C3H7BO2 | 96.000 | OB(O)C1CC1 | 25g | 117520278
Cyclopropylboronic acid | Combi-Blocks | 411235-57-9 | MFCD04038750 | 85.900 | C3H7BO2 | 96.000 | OB(O)C1CC1 | 25g | 117520278
eMolecules 411235-57-9 | Cyclopropylboronic acid | ChemScene | MFCD04038750 | 85.900 | C3H7BO2 | 95.000 | OB(O)C1CC1 | 100g | 536835227
Cyclopropylboronic acid | ChemScene | 411235-57-9 | MFCD04038750 | 85.900 | C3H7BO2 | 95.000 | OB(O)C1CC1 | 100g | 536835227
eMolecules 72824-04-5 | Allylboronic acid, pinacol cyclic ester | Oakwood Chemicals | MFCD00013347 | 168.040 | C9H17BO2 | 98.000 | CC1(C)OB(CC=C)OC1(C)C | 100g | 480113475
Allylboronic acid, pinacol cyclic ester | Oakwood Chemicals | 72824-04-5 | MFCD00013347 | 168.040 | C9H17BO2 | 98.000 | CC1(C)OB(CC=C)OC1(C)C | 100g | 480113475
eMolecules 126726-62-3 | Isopropenylboronic acid pinacol ester | Ambeed | MFCD08276843 | 168.040 | C9H17BO2 | 98.000 | CC(=C)B1OC(C)(C)C(C)(C)O1 | 10g | 526391937
Isopropenylboronic acid pinacol ester | Ambeed | 126726-62-3 | MFCD08276843 | 168.040 | C9H17BO2 | 98.000 | CC(=C)B1OC(C)(C)C(C)(C)O1 | 10g | 526391937